C26H37N7O6 — CID 70882198
[(4R,6R)-4-[6-(cyclohexylcarbamoylamino)purin-9-yl]spiro[3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-2,1'-cyclohexane]-6-yl]methyl N-ethylcarbamate (PubChem CID 70882198) has the molecular formula C26H37N7O6 and a molecular weight of 543.63 g/mol. Its IUPAC name is [(4R,6R)-4-[6-(cyclohexylcarbamoylamino)purin-9-yl]spiro[3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-2,1'-cyclohexane]-6-yl]methyl N-ethylcarbamate.
| Compound Name | [(4R,6R)-4-[6-(cyclohexylcarbamoylamino)purin-9-yl]spiro[3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-2,1'-cyclohexane]-6-yl]methyl N-ethylcarbamate |
|---|---|
| PubChem CID | 70882198 |
| Molecular Formula | C26H37N7O6 |
| Molecular Weight | 543.63 g/mol |
| Exact Mass | 543.28 |
| IUPAC Name | [(4R,6R)-4-[6-(cyclohexylcarbamoylamino)purin-9-yl]spiro[3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-2,1'-cyclohexane]-6-yl]methyl N-ethylcarbamate |
| SMILES | CCNC(=O)OC[C@H]1O[C@@H](n2cnc3c(NC(=O)NC4CCCCC4)ncnc32)C2OC3(CCCCC3)OC21 |
| InChI | InChI=1S/C26H37N7O6/c1-2-27-25(35)36-13-17-19-20(39-26(38-19)11-7-4-8-12-26)23(37-17)33-15-30-18-21(28-14-29-22(18)33)32-24(34)31-16-9-5-3-6-10-16/h14-17,19-20,23H,2-13H2,1H3,(H,27,35)(H2,28,29,31,32,34)/t17-,19?,20?,23-/m1/s1 |
| InChIKey | FDBDADZTYCMISM-AGTGTDPFSA-N |
| XLogP | 3.37 |
| TPSA | 150.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.63 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |