C23H32N6O5 — CID 46836549
1-[9-[(3aR,4R,6R,6aR)-6-(hydroxymethyl)spiro[3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-2,1'-cyclohexane]-4-yl]purin-6-yl]-3-cyclohexylurea (PubChem CID 46836549) has the molecular formula C23H32N6O5 and a molecular weight of 472.55 g/mol. Its IUPAC name is 1-[9-[(3aR,4R,6R,6aR)-6-(hydroxymethyl)spiro[3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-2,1'-cyclohexane]-4-yl]purin-6-yl]-3-cyclohexylurea.
| Compound Name | 1-[9-[(3aR,4R,6R,6aR)-6-(hydroxymethyl)spiro[3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-2,1'-cyclohexane]-4-yl]purin-6-yl]-3-cyclohexylurea |
|---|---|
| PubChem CID | 46836549 |
| Molecular Formula | C23H32N6O5 |
| Molecular Weight | 472.55 g/mol |
| Exact Mass | 472.24 |
| IUPAC Name | 1-[9-[(3aR,4R,6R,6aR)-6-(hydroxymethyl)spiro[3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-2,1'-cyclohexane]-4-yl]purin-6-yl]-3-cyclohexylurea |
| SMILES | O=C(Nc1ncnc2c1ncn2[C@@H]1O[C@H](CO)[C@H]2OC3(CCCCC3)O[C@H]21)NC1CCCCC1 |
| InChI | InChI=1S/C23H32N6O5/c30-11-15-17-18(34-23(33-17)9-5-2-6-10-23)21(32-15)29-13-26-16-19(24-12-25-20(16)29)28-22(31)27-14-7-3-1-4-8-14/h12-15,17-18,21,30H,1-11H2,(H2,24,25,27,28,31)/t15-,17-,18-,21-/m1/s1 |
| InChIKey | FAZWLMCRQUTZNL-QTQZEZTPSA-N |
| XLogP | 2.61 |
| TPSA | 132.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.55 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |