C22H23N5O5 — CID 59373209
(3aS,4R,6S)-4-(6-anilinopurin-9-yl)spiro[3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-2,1'-cyclohexane]-6-carboxylic acid (PubChem CID 59373209) has the molecular formula C22H23N5O5 and a molecular weight of 437.46 g/mol. Its IUPAC name is (3aS,4R,6S)-4-(6-anilinopurin-9-yl)spiro[3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-2,1'-cyclohexane]-6-carboxylic acid.
| Compound Name | (3aS,4R,6S)-4-(6-anilinopurin-9-yl)spiro[3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-2,1'-cyclohexane]-6-carboxylic acid |
|---|---|
| PubChem CID | 59373209 |
| Molecular Formula | C22H23N5O5 |
| Molecular Weight | 437.46 g/mol |
| Exact Mass | 437.17 |
| IUPAC Name | (3aS,4R,6S)-4-(6-anilinopurin-9-yl)spiro[3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-2,1'-cyclohexane]-6-carboxylic acid |
| SMILES | O=C(O)[C@H]1O[C@@H](n2cnc3c(Nc4ccccc4)ncnc32)[C@H]2OC3(CCCCC3)OC12 |
| InChI | InChI=1S/C22H23N5O5/c28-21(29)17-15-16(32-22(31-15)9-5-2-6-10-22)20(30-17)27-12-25-14-18(23-11-24-19(14)27)26-13-7-3-1-4-8-13/h1,3-4,7-8,11-12,15-17,20H,2,5-6,9-10H2,(H,28,29)(H,23,24,26)/t15?,16-,17-,20+/m0/s1 |
| InChIKey | MKSAVBKBNQVQEL-VZSDVLBXSA-N |
| XLogP | 3.00 |
| TPSA | 120.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.46 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |