C26H32N6O4 — CID 46836486
(3aR,4R,6S,6aS)-N-ethyl-4-[6-(2-phenylethylamino)purin-9-yl]spiro[3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-2,1'-cyclohexane]-6-carboxamide (PubChem CID 46836486) has the molecular formula C26H32N6O4 and a molecular weight of 492.58 g/mol. Its IUPAC name is (3aR,4R,6S,6aS)-N-ethyl-4-[6-(2-phenylethylamino)purin-9-yl]spiro[3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-2,1'-cyclohexane]-6-carboxamide.
| Compound Name | (3aR,4R,6S,6aS)-N-ethyl-4-[6-(2-phenylethylamino)purin-9-yl]spiro[3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-2,1'-cyclohexane]-6-carboxamide |
|---|---|
| PubChem CID | 46836486 |
| Molecular Formula | C26H32N6O4 |
| Molecular Weight | 492.58 g/mol |
| Exact Mass | 492.25 |
| IUPAC Name | (3aR,4R,6S,6aS)-N-ethyl-4-[6-(2-phenylethylamino)purin-9-yl]spiro[3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-2,1'-cyclohexane]-6-carboxamide |
| SMILES | CCNC(=O)[C@H]1O[C@@H](n2cnc3c(NCCc4ccccc4)ncnc32)[C@@H]2OC3(CCCCC3)O[C@@H]21 |
| InChI | InChI=1S/C26H32N6O4/c1-2-27-24(33)20-19-21(36-26(35-19)12-7-4-8-13-26)25(34-20)32-16-31-18-22(29-15-30-23(18)32)28-14-11-17-9-5-3-6-10-17/h3,5-6,9-10,15-16,19-21,25H,2,4,7-8,11-14H2,1H3,(H,27,33)(H,28,29,30)/t19-,20+,21-,25-/m1/s1 |
| InChIKey | YWJGFUCXDBVMRJ-FBROZUCGSA-N |
| XLogP | 2.96 |
| TPSA | 112.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.58 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |