C32H39N7O4 — CID 10099855
(3aR,4R,6S,6aS)-4-[6-[2-(1-cyclopentyl-2-methylindol-3-yl)ethylamino]purin-9-yl]-N-cyclopropyl-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-6-carboxamide (PubChem CID 10099855) has the molecular formula C32H39N7O4 and a molecular weight of 585.71 g/mol. Its IUPAC name is (3aR,4R,6S,6aS)-4-[6-[2-(1-cyclopentyl-2-methylindol-3-yl)ethylamino]purin-9-yl]-N-cyclopropyl-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-6-carboxamide.
| Compound Name | (3aR,4R,6S,6aS)-4-[6-[2-(1-cyclopentyl-2-methylindol-3-yl)ethylamino]purin-9-yl]-N-cyclopropyl-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-6-carboxamide |
|---|---|
| PubChem CID | 10099855 |
| Molecular Formula | C32H39N7O4 |
| Molecular Weight | 585.71 g/mol |
| Exact Mass | 585.31 |
| IUPAC Name | (3aR,4R,6S,6aS)-4-[6-[2-(1-cyclopentyl-2-methylindol-3-yl)ethylamino]purin-9-yl]-N-cyclopropyl-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-6-carboxamide |
| SMILES | Cc1c(CCNc2ncnc3c2ncn3[C@@H]2O[C@H](C(=O)NC3CC3)[C@H]3OC(C)(C)O[C@H]32)c2ccccc2n1C1CCCC1 |
| InChI | InChI=1S/C32H39N7O4/c1-18-21(22-10-6-7-11-23(22)39(18)20-8-4-5-9-20)14-15-33-28-24-29(35-16-34-28)38(17-36-24)31-27-25(42-32(2,3)43-27)26(41-31)30(40)37-19-12-13-19/h6-7,10-11,16-17,19-20,25-27,31H,4-5,8-9,12-15H2,1-3H3,(H,37,40)(H,33,34,35)/t25-,26+,27-,31-/m1/s1 |
| InChIKey | DEKUIWQRVPVWQX-KUYWTNKVSA-N |
| XLogP | 4.56 |
| TPSA | 117.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.71 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |