C22H26N10O7 — CID 73347573
(2S,3S,4R,5R)-N-ethyl-3,4-dihydroxy-5-[6-[4-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]butylamino]purin-9-yl]oxolane-2-carboxamide (PubChem CID 73347573) has the molecular formula C22H26N10O7 and a molecular weight of 542.51 g/mol. Its IUPAC name is (2S,3S,4R,5R)-N-ethyl-3,4-dihydroxy-5-[6-[4-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]butylamino]purin-9-yl]oxolane-2-carboxamide.
| Compound Name | (2S,3S,4R,5R)-N-ethyl-3,4-dihydroxy-5-[6-[4-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]butylamino]purin-9-yl]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 73347573 |
| Molecular Formula | C22H26N10O7 |
| Molecular Weight | 542.51 g/mol |
| Exact Mass | 542.20 |
| IUPAC Name | (2S,3S,4R,5R)-N-ethyl-3,4-dihydroxy-5-[6-[4-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]butylamino]purin-9-yl]oxolane-2-carboxamide |
| SMILES | CCNC(=O)[C@H]1O[C@@H](n2cnc3c(NCCCCNc4ccc([N+](=O)[O-])c5nonc45)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C22H26N10O7/c1-2-23-21(35)18-16(33)17(34)22(38-18)31-10-28-15-19(26-9-27-20(15)31)25-8-4-3-7-24-11-5-6-12(32(36)37)14-13(11)29-39-30-14/h5-6,9-10,16-18,22,24,33-34H,2-4,7-8H2,1H3,(H,23,35)(H,25,26,27)/t16-,17+,18-,22+/m0/s1 |
| InChIKey | SUIHHSFSJCVDHT-RQXXJAGISA-N |
| XLogP | 0.33 |
| TPSA | 228.51 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.51 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|