C24H31N8O7S- — CID 68900198
9-[(2R,3R,4S,5S)-5-(ethylcarbamoyl)-3,4-dihydroxyoxolan-2-yl]-6-[[3-[pentyl(sulfinato)amino]phenyl]carbamoylamino]purine (PubChem CID 68900198) has the molecular formula C24H31N8O7S- and a molecular weight of 575.63 g/mol. Its IUPAC name is 9-[(2R,3R,4S,5S)-5-(ethylcarbamoyl)-3,4-dihydroxyoxolan-2-yl]-6-[[3-[pentyl(sulfinato)amino]phenyl]carbamoylamino]purine.
| Compound Name | 9-[(2R,3R,4S,5S)-5-(ethylcarbamoyl)-3,4-dihydroxyoxolan-2-yl]-6-[[3-[pentyl(sulfinato)amino]phenyl]carbamoylamino]purine |
|---|---|
| PubChem CID | 68900198 |
| Molecular Formula | C24H31N8O7S- |
| Molecular Weight | 575.63 g/mol |
| Exact Mass | 575.20 |
| IUPAC Name | 9-[(2R,3R,4S,5S)-5-(ethylcarbamoyl)-3,4-dihydroxyoxolan-2-yl]-6-[[3-[pentyl(sulfinato)amino]phenyl]carbamoylamino]purine |
| SMILES | CCCCCN(c1cccc(NC(=O)Nc2ncnc3c2ncn3[C@@H]2O[C@H](C(=O)NCC)[C@@H](O)[C@H]2O)c1)S(=O)[O-] |
| InChI | InChI=1S/C24H32N8O7S/c1-3-5-6-10-32(40(37)38)15-9-7-8-14(11-15)29-24(36)30-20-16-21(27-12-26-20)31(13-28-16)23-18(34)17(33)19(39-23)22(35)25-4-2/h7-9,11-13,17-19,23,33-34H,3-6,10H2,1-2H3,(H,25,35)(H,37,38)(H2,26,27,29,30,36)/p-1/t17-,18+,19-,23+/m0/s1 |
| InChIKey | SWUXMBTZASPFPN-QPXQOZNCSA-M |
| XLogP | 1.02 |
| TPSA | 206.89 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.63 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|