C23H28N7O5 — CID 52942967
CID 52942967 (PubChem CID 52942967) has the molecular formula C23H28N7O5 and a molecular weight of 482.52 g/mol.
| Compound Name | CID 52942967 |
|---|---|
| PubChem CID | 52942967 |
| Molecular Formula | C23H28N7O5 |
| Molecular Weight | 482.52 g/mol |
| Exact Mass | 482.22 |
| IUPAC Name | — |
| SMILES | CNC(=O)[C@H]1O[C@@H](n2cnc3c(Nc4ccc5c(c4)C(C)(C)N([O])C5(C)C)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C23H28N7O5/c1-22(2)12-7-6-11(8-13(12)23(3,4)30(22)34)28-18-14-19(26-9-25-18)29(10-27-14)21-16(32)15(31)17(35-21)20(33)24-5/h6-10,15-17,21,31-32H,1-5H3,(H,24,33)(H,25,26,28)/t15-,16+,17-,21+/m0/s1 |
| InChIKey | RYAYBBPBSNJSLU-GRXQJBFDSA-N |
| XLogP | 1.07 |
| TPSA | 157.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.52 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |