C22H26N8O5 — CID 11477205
(2S,3S,4R,5R)-5-[6-[[2-(dimethylamino)-7-methyl-1,3-benzoxazol-5-yl]methylamino]purin-9-yl]-3,4-dihydroxy-N-methyloxolane-2-carboxamide (PubChem CID 11477205) has the molecular formula C22H26N8O5 and a molecular weight of 482.50 g/mol. Its IUPAC name is (2S,3S,4R,5R)-5-[6-[[2-(dimethylamino)-7-methyl-1,3-benzoxazol-5-yl]methylamino]purin-9-yl]-3,4-dihydroxy-N-methyloxolane-2-carboxamide.
| Compound Name | (2S,3S,4R,5R)-5-[6-[[2-(dimethylamino)-7-methyl-1,3-benzoxazol-5-yl]methylamino]purin-9-yl]-3,4-dihydroxy-N-methyloxolane-2-carboxamide |
|---|---|
| PubChem CID | 11477205 |
| Molecular Formula | C22H26N8O5 |
| Molecular Weight | 482.50 g/mol |
| Exact Mass | 482.20 |
| IUPAC Name | (2S,3S,4R,5R)-5-[6-[[2-(dimethylamino)-7-methyl-1,3-benzoxazol-5-yl]methylamino]purin-9-yl]-3,4-dihydroxy-N-methyloxolane-2-carboxamide |
| SMILES | CNC(=O)[C@H]1O[C@@H](n2cnc3c(NCc4cc(C)c5oc(N(C)C)nc5c4)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C22H26N8O5/c1-10-5-11(6-12-16(10)35-22(28-12)29(3)4)7-24-18-13-19(26-8-25-18)30(9-27-13)21-15(32)14(31)17(34-21)20(33)23-2/h5-6,8-9,14-15,17,21,31-32H,7H2,1-4H3,(H,23,33)(H,24,25,26)/t14-,15+,17-,21+/m0/s1 |
| InChIKey | JSKFYNDEGMAEJB-ATUDVECKSA-N |
| XLogP | 0.32 |
| TPSA | 163.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.50 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |