C23H26F3N9O5 — CID 11376474
(2S,3S,4R,5R)-5-[6-[[2-(diethylamino)-7-(trifluoromethyl)-[1,3]oxazolo[4,5-b]pyridin-5-yl]methylamino]purin-9-yl]-3,4-dihydroxy-N-methyloxolane-2-carboxamide (PubChem CID 11376474) has the molecular formula C23H26F3N9O5 and a molecular weight of 565.51 g/mol. Its IUPAC name is (2S,3S,4R,5R)-5-[6-[[2-(diethylamino)-7-(trifluoromethyl)-[1,3]oxazolo[4,5-b]pyridin-5-yl]methylamino]purin-9-yl]-3,4-dihydroxy-N-methyloxolane-2-carboxamide.
| Compound Name | (2S,3S,4R,5R)-5-[6-[[2-(diethylamino)-7-(trifluoromethyl)-[1,3]oxazolo[4,5-b]pyridin-5-yl]methylamino]purin-9-yl]-3,4-dihydroxy-N-methyloxolane-2-carboxamide |
|---|---|
| PubChem CID | 11376474 |
| Molecular Formula | C23H26F3N9O5 |
| Molecular Weight | 565.51 g/mol |
| Exact Mass | 565.20 |
| IUPAC Name | (2S,3S,4R,5R)-5-[6-[[2-(diethylamino)-7-(trifluoromethyl)-[1,3]oxazolo[4,5-b]pyridin-5-yl]methylamino]purin-9-yl]-3,4-dihydroxy-N-methyloxolane-2-carboxamide |
| SMILES | CCN(CC)c1nc2nc(CNc3ncnc4c3ncn4[C@@H]3O[C@H](C(=O)NC)[C@@H](O)[C@H]3O)cc(C(F)(F)F)c2o1 |
| InChI | InChI=1S/C23H26F3N9O5/c1-4-34(5-2)22-33-18-15(40-22)11(23(24,25)26)6-10(32-18)7-28-17-12-19(30-8-29-17)35(9-31-12)21-14(37)13(36)16(39-21)20(38)27-3/h6,8-9,13-14,16,21,36-37H,4-5,7H2,1-3H3,(H,27,38)(H,28,29,30)/t13-,14+,16-,21+/m0/s1 |
| InChIKey | DTNZXSREEJCNJE-GUUAHRICSA-N |
| XLogP | 1.20 |
| TPSA | 176.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.51 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |