C24H23F3N8O5 — CID 164562337
(2S,3S,4R,5R)-3,4-dihydroxy-5-[2-(5-methoxy-3-pyridinyl)-6-[[6-(trifluoromethyl)-2-pyridinyl]methylamino]purin-9-yl]-N-methyloxolane-2-carboxamide (PubChem CID 164562337) has the molecular formula C24H23F3N8O5 and a molecular weight of 560.49 g/mol. Its IUPAC name is (2S,3S,4R,5R)-3,4-dihydroxy-5-[2-(5-methoxy-3-pyridinyl)-6-[[6-(trifluoromethyl)-2-pyridinyl]methylamino]purin-9-yl]-N-methyloxolane-2-carboxamide.
| Compound Name | (2S,3S,4R,5R)-3,4-dihydroxy-5-[2-(5-methoxy-3-pyridinyl)-6-[[6-(trifluoromethyl)-2-pyridinyl]methylamino]purin-9-yl]-N-methyloxolane-2-carboxamide |
|---|---|
| PubChem CID | 164562337 |
| Molecular Formula | C24H23F3N8O5 |
| Molecular Weight | 560.49 g/mol |
| Exact Mass | 560.17 |
| IUPAC Name | (2S,3S,4R,5R)-3,4-dihydroxy-5-[2-(5-methoxy-3-pyridinyl)-6-[[6-(trifluoromethyl)-2-pyridinyl]methylamino]purin-9-yl]-N-methyloxolane-2-carboxamide |
| SMILES | CNC(=O)[C@H]1O[C@@H](n2cnc3c(NCc4cccc(C(F)(F)F)n4)nc(-c4cncc(OC)c4)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C24H23F3N8O5/c1-28-22(38)18-16(36)17(37)23(40-18)35-10-31-15-20(30-8-12-4-3-5-14(32-12)24(25,26)27)33-19(34-21(15)35)11-6-13(39-2)9-29-7-11/h3-7,9-10,16-18,23,36-37H,8H2,1-2H3,(H,28,38)(H,30,33,34)/t16-,17+,18-,23+/m0/s1 |
| InChIKey | QZINYDUOCVHRJR-DDOIHHOZSA-N |
| XLogP | 1.29 |
| TPSA | 169.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.49 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |