C24H22F3N7O4 — CID 164562543
(2S,3S,4R,5R)-3,4-dihydroxy-N-methyl-5-[2-pyridin-3-yl-6-[[3-(trifluoromethyl)phenyl]methylamino]purin-9-yl]oxolane-2-carboxamide (PubChem CID 164562543) has the molecular formula C24H22F3N7O4 and a molecular weight of 529.48 g/mol. Its IUPAC name is (2S,3S,4R,5R)-3,4-dihydroxy-N-methyl-5-[2-pyridin-3-yl-6-[[3-(trifluoromethyl)phenyl]methylamino]purin-9-yl]oxolane-2-carboxamide.
| Compound Name | (2S,3S,4R,5R)-3,4-dihydroxy-N-methyl-5-[2-pyridin-3-yl-6-[[3-(trifluoromethyl)phenyl]methylamino]purin-9-yl]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 164562543 |
| Molecular Formula | C24H22F3N7O4 |
| Molecular Weight | 529.48 g/mol |
| Exact Mass | 529.17 |
| IUPAC Name | (2S,3S,4R,5R)-3,4-dihydroxy-N-methyl-5-[2-pyridin-3-yl-6-[[3-(trifluoromethyl)phenyl]methylamino]purin-9-yl]oxolane-2-carboxamide |
| SMILES | CNC(=O)[C@H]1O[C@@H](n2cnc3c(NCc4cccc(C(F)(F)F)c4)nc(-c4cccnc4)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C24H22F3N7O4/c1-28-22(37)18-16(35)17(36)23(38-18)34-11-31-15-20(30-9-12-4-2-6-14(8-12)24(25,26)27)32-19(33-21(15)34)13-5-3-7-29-10-13/h2-8,10-11,16-18,23,35-36H,9H2,1H3,(H,28,37)(H,30,32,33)/t16-,17+,18-,23+/m0/s1 |
| InChIKey | CBVBJRHRTWTPKI-DDOIHHOZSA-N |
| XLogP | 1.88 |
| TPSA | 147.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.48 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |