C24H24FN7O4 — CID 164562564
(2S,3S,4R,5R)-5-[2-(5-fluoro-3-pyridinyl)-6-[(3-methylphenyl)methylamino]purin-9-yl]-3,4-dihydroxy-N-methyloxolane-2-carboxamide (PubChem CID 164562564) has the molecular formula C24H24FN7O4 and a molecular weight of 493.50 g/mol. Its IUPAC name is (2S,3S,4R,5R)-5-[2-(5-fluoro-3-pyridinyl)-6-[(3-methylphenyl)methylamino]purin-9-yl]-3,4-dihydroxy-N-methyloxolane-2-carboxamide.
| Compound Name | (2S,3S,4R,5R)-5-[2-(5-fluoro-3-pyridinyl)-6-[(3-methylphenyl)methylamino]purin-9-yl]-3,4-dihydroxy-N-methyloxolane-2-carboxamide |
|---|---|
| PubChem CID | 164562564 |
| Molecular Formula | C24H24FN7O4 |
| Molecular Weight | 493.50 g/mol |
| Exact Mass | 493.19 |
| IUPAC Name | (2S,3S,4R,5R)-5-[2-(5-fluoro-3-pyridinyl)-6-[(3-methylphenyl)methylamino]purin-9-yl]-3,4-dihydroxy-N-methyloxolane-2-carboxamide |
| SMILES | CNC(=O)[C@H]1O[C@@H](n2cnc3c(NCc4cccc(C)c4)nc(-c4cncc(F)c4)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C24H24FN7O4/c1-12-4-3-5-13(6-12)8-28-21-16-22(31-20(30-21)14-7-15(25)10-27-9-14)32(11-29-16)24-18(34)17(33)19(36-24)23(35)26-2/h3-7,9-11,17-19,24,33-34H,8H2,1-2H3,(H,26,35)(H,28,30,31)/t17-,18+,19-,24+/m0/s1 |
| InChIKey | HHJFTCFNSSUTNV-UAKAABGRSA-N |
| XLogP | 1.31 |
| TPSA | 147.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.50 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |