C22H20BrClN8O4 — CID 164562430
(2S,3S,4R,5R)-5-[6-[(6-bromo-2-pyridinyl)methylamino]-2-(5-chloro-3-pyridinyl)purin-9-yl]-3,4-dihydroxy-N-(trideuteriomethyl)oxolane-2-carboxamide (PubChem CID 164562430) has the molecular formula C22H20BrClN8O4 and a molecular weight of 578.83 g/mol. Its IUPAC name is (2S,3S,4R,5R)-5-[6-[(6-bromo-2-pyridinyl)methylamino]-2-(5-chloro-3-pyridinyl)purin-9-yl]-3,4-dihydroxy-N-(trideuteriomethyl)oxolane-2-carboxamide.
| Compound Name | (2S,3S,4R,5R)-5-[6-[(6-bromo-2-pyridinyl)methylamino]-2-(5-chloro-3-pyridinyl)purin-9-yl]-3,4-dihydroxy-N-(trideuteriomethyl)oxolane-2-carboxamide |
|---|---|
| PubChem CID | 164562430 |
| Molecular Formula | C22H20BrClN8O4 |
| Molecular Weight | 578.83 g/mol |
| Exact Mass | 577.07 |
| IUPAC Name | (2S,3S,4R,5R)-5-[6-[(6-bromo-2-pyridinyl)methylamino]-2-(5-chloro-3-pyridinyl)purin-9-yl]-3,4-dihydroxy-N-(trideuteriomethyl)oxolane-2-carboxamide |
| SMILES | [2H]C([2H])([2H])NC(=O)[C@H]1O[C@@H](n2cnc3c(NCc4cccc(Br)n4)nc(-c4cncc(Cl)c4)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C22H20BrClN8O4/c1-25-21(35)17-15(33)16(34)22(36-17)32-9-28-14-19(27-8-12-3-2-4-13(23)29-12)30-18(31-20(14)32)10-5-11(24)7-26-6-10/h2-7,9,15-17,22,33-34H,8H2,1H3,(H,25,35)(H,27,30,31)/t15-,16+,17-,22+/m0/s1/i1D3 |
| InChIKey | SBIZXQAAEQKKDS-IFVPZOQXSA-N |
| XLogP | 1.68 |
| TPSA | 160.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.83 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|