C19H20ClN11O4 — CID 164562366
(2S,3S,4R,5R)-5-[2-(5-chloro-3-pyridinyl)-6-[(2-methyltetrazol-5-yl)methylamino]purin-9-yl]-3,4-dihydroxy-N-(trideuteriomethyl)oxolane-2-carboxamide (PubChem CID 164562366) has the molecular formula C19H20ClN11O4 and a molecular weight of 504.91 g/mol. Its IUPAC name is (2S,3S,4R,5R)-5-[2-(5-chloro-3-pyridinyl)-6-[(2-methyltetrazol-5-yl)methylamino]purin-9-yl]-3,4-dihydroxy-N-(trideuteriomethyl)oxolane-2-carboxamide.
| Compound Name | (2S,3S,4R,5R)-5-[2-(5-chloro-3-pyridinyl)-6-[(2-methyltetrazol-5-yl)methylamino]purin-9-yl]-3,4-dihydroxy-N-(trideuteriomethyl)oxolane-2-carboxamide |
|---|---|
| PubChem CID | 164562366 |
| Molecular Formula | C19H20ClN11O4 |
| Molecular Weight | 504.91 g/mol |
| Exact Mass | 504.16 |
| IUPAC Name | (2S,3S,4R,5R)-5-[2-(5-chloro-3-pyridinyl)-6-[(2-methyltetrazol-5-yl)methylamino]purin-9-yl]-3,4-dihydroxy-N-(trideuteriomethyl)oxolane-2-carboxamide |
| SMILES | [2H]C([2H])([2H])NC(=O)[C@H]1O[C@@H](n2cnc3c(NCc4nnn(C)n4)nc(-c4cncc(Cl)c4)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C19H20ClN11O4/c1-21-18(34)14-12(32)13(33)19(35-14)31-7-24-11-16(23-6-10-27-29-30(2)28-10)25-15(26-17(11)31)8-3-9(20)5-22-4-8/h3-5,7,12-14,19,32-33H,6H2,1-2H3,(H,21,34)(H,23,25,26)/t12-,13+,14-,19+/m0/s1/i1D3 |
| InChIKey | YMWTUYMFVOLYJX-LKDOHDCYSA-N |
| XLogP | -0.96 |
| TPSA | 190.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.91 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |