C25H25N9O4 — CID 171422305
(2S,3S,4R,5R)-5-[6-(benzylamino)-2-(1-methylpyrazolo[3,4-b]pyridin-5-yl)purin-9-yl]-3,4-dihydroxy-N-(trideuteriomethyl)oxolane-2-carboxamide (PubChem CID 171422305) has the molecular formula C25H25N9O4 and a molecular weight of 518.55 g/mol. Its IUPAC name is (2S,3S,4R,5R)-5-[6-(benzylamino)-2-(1-methylpyrazolo[3,4-b]pyridin-5-yl)purin-9-yl]-3,4-dihydroxy-N-(trideuteriomethyl)oxolane-2-carboxamide.
| Compound Name | (2S,3S,4R,5R)-5-[6-(benzylamino)-2-(1-methylpyrazolo[3,4-b]pyridin-5-yl)purin-9-yl]-3,4-dihydroxy-N-(trideuteriomethyl)oxolane-2-carboxamide |
|---|---|
| PubChem CID | 171422305 |
| Molecular Formula | C25H25N9O4 |
| Molecular Weight | 518.55 g/mol |
| Exact Mass | 518.22 |
| IUPAC Name | (2S,3S,4R,5R)-5-[6-(benzylamino)-2-(1-methylpyrazolo[3,4-b]pyridin-5-yl)purin-9-yl]-3,4-dihydroxy-N-(trideuteriomethyl)oxolane-2-carboxamide |
| SMILES | [2H]C([2H])([2H])NC(=O)[C@H]1O[C@@H](n2cnc3c(NCc4ccccc4)nc(-c4cnc5c(cnn5C)c4)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C25H25N9O4/c1-26-24(37)19-17(35)18(36)25(38-19)34-12-29-16-21(27-9-13-6-4-3-5-7-13)31-20(32-23(16)34)14-8-15-11-30-33(2)22(15)28-10-14/h3-8,10-12,17-19,25,35-36H,9H2,1-2H3,(H,26,37)(H,27,31,32)/t17-,18+,19-,25+/m0/s1/i1D3 |
| InChIKey | HQECYTWWCRRVGN-VDSVGXHASA-N |
| XLogP | 0.75 |
| TPSA | 165.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.55 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |