C27H30N6O6 — CID 164562519
(2S,3S,4R,5R)-5-[6-(benzylamino)-2-[4-(2-methoxyethoxy)phenyl]purin-9-yl]-3,4-dihydroxy-N-methyloxolane-2-carboxamide (PubChem CID 164562519) has the molecular formula C27H30N6O6 and a molecular weight of 534.57 g/mol. Its IUPAC name is (2S,3S,4R,5R)-5-[6-(benzylamino)-2-[4-(2-methoxyethoxy)phenyl]purin-9-yl]-3,4-dihydroxy-N-methyloxolane-2-carboxamide.
| Compound Name | (2S,3S,4R,5R)-5-[6-(benzylamino)-2-[4-(2-methoxyethoxy)phenyl]purin-9-yl]-3,4-dihydroxy-N-methyloxolane-2-carboxamide |
|---|---|
| PubChem CID | 164562519 |
| Molecular Formula | C27H30N6O6 |
| Molecular Weight | 534.57 g/mol |
| Exact Mass | 534.22 |
| IUPAC Name | (2S,3S,4R,5R)-5-[6-(benzylamino)-2-[4-(2-methoxyethoxy)phenyl]purin-9-yl]-3,4-dihydroxy-N-methyloxolane-2-carboxamide |
| SMILES | CNC(=O)[C@H]1O[C@@H](n2cnc3c(NCc4ccccc4)nc(-c4ccc(OCCOC)cc4)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C27H30N6O6/c1-28-26(36)22-20(34)21(35)27(39-22)33-15-30-19-24(29-14-16-6-4-3-5-7-16)31-23(32-25(19)33)17-8-10-18(11-9-17)38-13-12-37-2/h3-11,15,20-22,27,34-35H,12-14H2,1-2H3,(H,28,36)(H,29,31,32)/t20-,21+,22-,27+/m0/s1 |
| InChIKey | IHHSIDLPAVIRHG-JLFWUPFSSA-N |
| XLogP | 1.50 |
| TPSA | 152.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.57 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|