C24H23BrClN7O4 — CID 164562571
(2S,3S,4R,5R)-5-[6-[(3-bromophenyl)methylamino]-2-(5-chloro-3-pyridinyl)purin-9-yl]-N-ethyl-3,4-dihydroxyoxolane-2-carboxamide (PubChem CID 164562571) has the molecular formula C24H23BrClN7O4 and a molecular weight of 588.85 g/mol. Its IUPAC name is (2S,3S,4R,5R)-5-[6-[(3-bromophenyl)methylamino]-2-(5-chloro-3-pyridinyl)purin-9-yl]-N-ethyl-3,4-dihydroxyoxolane-2-carboxamide.
| Compound Name | (2S,3S,4R,5R)-5-[6-[(3-bromophenyl)methylamino]-2-(5-chloro-3-pyridinyl)purin-9-yl]-N-ethyl-3,4-dihydroxyoxolane-2-carboxamide |
|---|---|
| PubChem CID | 164562571 |
| Molecular Formula | C24H23BrClN7O4 |
| Molecular Weight | 588.85 g/mol |
| Exact Mass | 587.07 |
| IUPAC Name | (2S,3S,4R,5R)-5-[6-[(3-bromophenyl)methylamino]-2-(5-chloro-3-pyridinyl)purin-9-yl]-N-ethyl-3,4-dihydroxyoxolane-2-carboxamide |
| SMILES | CCNC(=O)[C@H]1O[C@@H](n2cnc3c(NCc4cccc(Br)c4)nc(-c4cncc(Cl)c4)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C24H23BrClN7O4/c1-2-28-23(36)19-17(34)18(35)24(37-19)33-11-30-16-21(29-8-12-4-3-5-14(25)6-12)31-20(32-22(16)33)13-7-15(26)10-27-9-13/h3-7,9-11,17-19,24,34-35H,2,8H2,1H3,(H,28,36)(H,29,31,32)/t17-,18+,19-,24+/m0/s1 |
| InChIKey | AQSSMKYJVGULNI-UAKAABGRSA-N |
| XLogP | 2.67 |
| TPSA | 147.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.85 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |