C23H20ClF3N8O4 — CID 170317194
(2S,3S,4R,5R)-5-[2-(5-chloro-3-pyridinyl)-6-(pyridin-2-ylmethylamino)purin-9-yl]-3,4-dihydroxy-N-(2,2,2-trifluoroethyl)oxolane-2-carboxamide (PubChem CID 170317194) has the molecular formula C23H20ClF3N8O4 and a molecular weight of 564.91 g/mol. Its IUPAC name is (2S,3S,4R,5R)-5-[2-(5-chloro-3-pyridinyl)-6-(pyridin-2-ylmethylamino)purin-9-yl]-3,4-dihydroxy-N-(2,2,2-trifluoroethyl)oxolane-2-carboxamide.
| Compound Name | (2S,3S,4R,5R)-5-[2-(5-chloro-3-pyridinyl)-6-(pyridin-2-ylmethylamino)purin-9-yl]-3,4-dihydroxy-N-(2,2,2-trifluoroethyl)oxolane-2-carboxamide |
|---|---|
| PubChem CID | 170317194 |
| Molecular Formula | C23H20ClF3N8O4 |
| Molecular Weight | 564.91 g/mol |
| Exact Mass | 564.12 |
| IUPAC Name | (2S,3S,4R,5R)-5-[2-(5-chloro-3-pyridinyl)-6-(pyridin-2-ylmethylamino)purin-9-yl]-3,4-dihydroxy-N-(2,2,2-trifluoroethyl)oxolane-2-carboxamide |
| SMILES | O=C(NCC(F)(F)F)[C@H]1O[C@@H](n2cnc3c(NCc4ccccn4)nc(-c4cncc(Cl)c4)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C23H20ClF3N8O4/c24-12-5-11(6-28-7-12)18-33-19(30-8-13-3-1-2-4-29-13)14-20(34-18)35(10-32-14)22-16(37)15(36)17(39-22)21(38)31-9-23(25,26)27/h1-7,10,15-17,22,36-37H,8-9H2,(H,31,38)(H,30,33,34)/t15-,16+,17-,22+/m0/s1 |
| InChIKey | MCKXFYSNEAFKQQ-DVSDUFGPSA-N |
| XLogP | 1.85 |
| TPSA | 160.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.91 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |