C24H25FN8O4 — CID 170317178
(2S,3S,4R,5R)-5-[2-(5-fluoro-3-pyridinyl)-6-(pyridin-2-ylmethylamino)purin-9-yl]-3,4-dihydroxy-N-propan-2-yloxolane-2-carboxamide (PubChem CID 170317178) has the molecular formula C24H25FN8O4 and a molecular weight of 508.51 g/mol. Its IUPAC name is (2S,3S,4R,5R)-5-[2-(5-fluoro-3-pyridinyl)-6-(pyridin-2-ylmethylamino)purin-9-yl]-3,4-dihydroxy-N-propan-2-yloxolane-2-carboxamide.
| Compound Name | (2S,3S,4R,5R)-5-[2-(5-fluoro-3-pyridinyl)-6-(pyridin-2-ylmethylamino)purin-9-yl]-3,4-dihydroxy-N-propan-2-yloxolane-2-carboxamide |
|---|---|
| PubChem CID | 170317178 |
| Molecular Formula | C24H25FN8O4 |
| Molecular Weight | 508.51 g/mol |
| Exact Mass | 508.20 |
| IUPAC Name | (2S,3S,4R,5R)-5-[2-(5-fluoro-3-pyridinyl)-6-(pyridin-2-ylmethylamino)purin-9-yl]-3,4-dihydroxy-N-propan-2-yloxolane-2-carboxamide |
| SMILES | CC(C)NC(=O)[C@H]1O[C@@H](n2cnc3c(NCc4ccccn4)nc(-c4cncc(F)c4)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C24H25FN8O4/c1-12(2)30-23(36)19-17(34)18(35)24(37-19)33-11-29-16-21(28-10-15-5-3-4-6-27-15)31-20(32-22(16)33)13-7-14(25)9-26-8-13/h3-9,11-12,17-19,24,34-35H,10H2,1-2H3,(H,30,36)(H,28,31,32)/t17-,18+,19-,24+/m0/s1 |
| InChIKey | LYMVSEUYNQIKFO-UAKAABGRSA-N |
| XLogP | 1.18 |
| TPSA | 160.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.51 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |