C22H21FN8O5S — CID 170317331
(2S,3S,4R,5R)-5-[2-(5-fluoro-3-pyridinyl)-6-(pyridin-2-ylmethylamino)purin-9-yl]-3,4-dihydroxy-N-methyl-1,1-dioxothiolane-2-carboxamide (PubChem CID 170317331) has the molecular formula C22H21FN8O5S and a molecular weight of 528.53 g/mol. Its IUPAC name is (2S,3S,4R,5R)-5-[2-(5-fluoro-3-pyridinyl)-6-(pyridin-2-ylmethylamino)purin-9-yl]-3,4-dihydroxy-N-methyl-1,1-dioxothiolane-2-carboxamide.
| Compound Name | (2S,3S,4R,5R)-5-[2-(5-fluoro-3-pyridinyl)-6-(pyridin-2-ylmethylamino)purin-9-yl]-3,4-dihydroxy-N-methyl-1,1-dioxothiolane-2-carboxamide |
|---|---|
| PubChem CID | 170317331 |
| Molecular Formula | C22H21FN8O5S |
| Molecular Weight | 528.53 g/mol |
| Exact Mass | 528.13 |
| IUPAC Name | (2S,3S,4R,5R)-5-[2-(5-fluoro-3-pyridinyl)-6-(pyridin-2-ylmethylamino)purin-9-yl]-3,4-dihydroxy-N-methyl-1,1-dioxothiolane-2-carboxamide |
| SMILES | CNC(=O)[C@@H]1[C@@H](O)[C@@H](O)[C@H](n2cnc3c(NCc4ccccn4)nc(-c4cncc(F)c4)nc32)S1(=O)=O |
| InChI | InChI=1S/C22H21FN8O5S/c1-24-21(34)17-15(32)16(33)22(37(17,35)36)31-10-28-14-19(27-9-13-4-2-3-5-26-13)29-18(30-20(14)31)11-6-12(23)8-25-7-11/h2-8,10,15-17,22,32-33H,9H2,1H3,(H,24,34)(H,27,29,30)/t15-,16+,17-,22+/m0/s1 |
| InChIKey | WWFFUYZCVFKRST-DVSDUFGPSA-N |
| XLogP | -0.20 |
| TPSA | 185.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.53 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |