C23H23ClN8O3 — CID 170317272
(2S,3R,4S,5S)-5-[6-(benzylamino)-2-(5-chloro-3-pyridinyl)purin-9-yl]-3,4-dihydroxy-N-methylpyrrolidine-2-carboxamide (PubChem CID 170317272) has the molecular formula C23H23ClN8O3 and a molecular weight of 494.94 g/mol. Its IUPAC name is (2S,3R,4S,5S)-5-[6-(benzylamino)-2-(5-chloro-3-pyridinyl)purin-9-yl]-3,4-dihydroxy-N-methylpyrrolidine-2-carboxamide.
| Compound Name | (2S,3R,4S,5S)-5-[6-(benzylamino)-2-(5-chloro-3-pyridinyl)purin-9-yl]-3,4-dihydroxy-N-methylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 170317272 |
| Molecular Formula | C23H23ClN8O3 |
| Molecular Weight | 494.94 g/mol |
| Exact Mass | 494.16 |
| IUPAC Name | (2S,3R,4S,5S)-5-[6-(benzylamino)-2-(5-chloro-3-pyridinyl)purin-9-yl]-3,4-dihydroxy-N-methylpyrrolidine-2-carboxamide |
| SMILES | CNC(=O)[C@H]1N[C@@H](n2cnc3c(NCc4ccccc4)nc(-c4cncc(Cl)c4)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C23H23ClN8O3/c1-25-23(35)15-17(33)18(34)22(29-15)32-11-28-16-20(27-8-12-5-3-2-4-6-12)30-19(31-21(16)32)13-7-14(24)10-26-9-13/h2-7,9-11,15,17-18,22,29,33-34H,8H2,1H3,(H,25,35)(H,27,30,31)/t15-,17+,18+,22-/m0/s1 |
| InChIKey | WBJKMCGWYRYJSR-BREDGVMVSA-N |
| XLogP | 1.09 |
| TPSA | 150.11 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.94 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |