C24H23ClFN7O5S — CID 171422278
(2S,3S,4R,5R)-5-[2-(5-chloro-3-pyridinyl)-6-[(2-fluoro-5-methylphenyl)methylamino]purin-9-yl]-3,4-dihydroxy-N-methyl-1,1-dioxothiolane-2-carboxamide (PubChem CID 171422278) has the molecular formula C24H23ClFN7O5S and a molecular weight of 576.01 g/mol. Its IUPAC name is (2S,3S,4R,5R)-5-[2-(5-chloro-3-pyridinyl)-6-[(2-fluoro-5-methylphenyl)methylamino]purin-9-yl]-3,4-dihydroxy-N-methyl-1,1-dioxothiolane-2-carboxamide.
| Compound Name | (2S,3S,4R,5R)-5-[2-(5-chloro-3-pyridinyl)-6-[(2-fluoro-5-methylphenyl)methylamino]purin-9-yl]-3,4-dihydroxy-N-methyl-1,1-dioxothiolane-2-carboxamide |
|---|---|
| PubChem CID | 171422278 |
| Molecular Formula | C24H23ClFN7O5S |
| Molecular Weight | 576.01 g/mol |
| Exact Mass | 575.12 |
| IUPAC Name | (2S,3S,4R,5R)-5-[2-(5-chloro-3-pyridinyl)-6-[(2-fluoro-5-methylphenyl)methylamino]purin-9-yl]-3,4-dihydroxy-N-methyl-1,1-dioxothiolane-2-carboxamide |
| SMILES | CNC(=O)[C@@H]1[C@@H](O)[C@@H](O)[C@H](n2cnc3c(NCc4cc(C)ccc4F)nc(-c4cncc(Cl)c4)nc32)S1(=O)=O |
| InChI | InChI=1S/C24H23ClFN7O5S/c1-11-3-4-15(26)12(5-11)8-29-21-16-22(32-20(31-21)13-6-14(25)9-28-7-13)33(10-30-16)24-18(35)17(34)19(23(36)27-2)39(24,37)38/h3-7,9-10,17-19,24,34-35H,8H2,1-2H3,(H,27,36)(H,29,31,32)/t17-,18+,19-,24+/m0/s1 |
| InChIKey | BGNVAPSDNWJVAC-UAKAABGRSA-N |
| XLogP | 1.36 |
| TPSA | 172.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.01 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |