C25H25ClN8O3 — CID 170317328
(1S,2R,3S,5S)-4-[2-(5-chloro-3-pyridinyl)-6-[(4-methyl-2-pyridinyl)methylamino]purin-9-yl]-2,3-dihydroxy-N-methylbicyclo[3.1.0]hexane-1-carboxamide (PubChem CID 170317328) has the molecular formula C25H25ClN8O3 and a molecular weight of 520.98 g/mol. Its IUPAC name is (1S,2R,3S,5S)-4-[2-(5-chloro-3-pyridinyl)-6-[(4-methyl-2-pyridinyl)methylamino]purin-9-yl]-2,3-dihydroxy-N-methylbicyclo[3.1.0]hexane-1-carboxamide.
| Compound Name | (1S,2R,3S,5S)-4-[2-(5-chloro-3-pyridinyl)-6-[(4-methyl-2-pyridinyl)methylamino]purin-9-yl]-2,3-dihydroxy-N-methylbicyclo[3.1.0]hexane-1-carboxamide |
|---|---|
| PubChem CID | 170317328 |
| Molecular Formula | C25H25ClN8O3 |
| Molecular Weight | 520.98 g/mol |
| Exact Mass | 520.17 |
| IUPAC Name | (1S,2R,3S,5S)-4-[2-(5-chloro-3-pyridinyl)-6-[(4-methyl-2-pyridinyl)methylamino]purin-9-yl]-2,3-dihydroxy-N-methylbicyclo[3.1.0]hexane-1-carboxamide |
| SMILES | CNC(=O)[C@@]12C[C@@H]1C(n1cnc3c(NCc4cc(C)ccn4)nc(-c4cncc(Cl)c4)nc31)[C@H](O)[C@@H]2O |
| InChI | InChI=1S/C25H25ClN8O3/c1-12-3-4-29-15(5-12)10-30-22-17-23(33-21(32-22)13-6-14(26)9-28-8-13)34(11-31-17)18-16-7-25(16,24(37)27-2)20(36)19(18)35/h3-6,8-9,11,16,18-20,35-36H,7,10H2,1-2H3,(H,27,37)(H,30,32,33)/t16-,18?,19+,20+,25+/m1/s1 |
| InChIKey | RZORRMYEDGVVAV-FUWJIJKLSA-N |
| XLogP | 1.89 |
| TPSA | 150.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.98 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |