C26H27N7O4 — CID 167153239
(1R,2R,3S,5S)-4-[6-(benzylamino)-2-(5-methoxy-3-pyridinyl)purin-9-yl]-2,3-dihydroxy-N-methylbicyclo[3.1.0]hexane-1-carboxamide (PubChem CID 167153239) has the molecular formula C26H27N7O4 and a molecular weight of 501.55 g/mol. Its IUPAC name is (1R,2R,3S,5S)-4-[6-(benzylamino)-2-(5-methoxy-3-pyridinyl)purin-9-yl]-2,3-dihydroxy-N-methylbicyclo[3.1.0]hexane-1-carboxamide.
| Compound Name | (1R,2R,3S,5S)-4-[6-(benzylamino)-2-(5-methoxy-3-pyridinyl)purin-9-yl]-2,3-dihydroxy-N-methylbicyclo[3.1.0]hexane-1-carboxamide |
|---|---|
| PubChem CID | 167153239 |
| Molecular Formula | C26H27N7O4 |
| Molecular Weight | 501.55 g/mol |
| Exact Mass | 501.21 |
| IUPAC Name | (1R,2R,3S,5S)-4-[6-(benzylamino)-2-(5-methoxy-3-pyridinyl)purin-9-yl]-2,3-dihydroxy-N-methylbicyclo[3.1.0]hexane-1-carboxamide |
| SMILES | CNC(=O)[C@]12C[C@@H]1C(n1cnc3c(NCc4ccccc4)nc(-c4cncc(OC)c4)nc31)[C@H](O)[C@@H]2O |
| InChI | InChI=1S/C26H27N7O4/c1-27-25(36)26-9-17(26)19(20(34)21(26)35)33-13-30-18-23(29-10-14-6-4-3-5-7-14)31-22(32-24(18)33)15-8-16(37-2)12-28-11-15/h3-8,11-13,17,19-21,34-35H,9-10H2,1-2H3,(H,27,36)(H,29,31,32)/t17-,19?,20+,21+,26-/m1/s1 |
| InChIKey | CGISUMZHUIIMML-IDQKTWRISA-N |
| XLogP | 1.54 |
| TPSA | 147.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.55 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |