C24H26N8O5 — CID 170317248
(2S,3S,4R,5R)-N-ethyl-3,4-dihydroxy-5-[2-(5-methoxy-3-pyridinyl)-6-(pyridin-2-ylmethylamino)purin-9-yl]oxolane-2-carboxamide (PubChem CID 170317248) has the molecular formula C24H26N8O5 and a molecular weight of 506.52 g/mol. Its IUPAC name is (2S,3S,4R,5R)-N-ethyl-3,4-dihydroxy-5-[2-(5-methoxy-3-pyridinyl)-6-(pyridin-2-ylmethylamino)purin-9-yl]oxolane-2-carboxamide.
| Compound Name | (2S,3S,4R,5R)-N-ethyl-3,4-dihydroxy-5-[2-(5-methoxy-3-pyridinyl)-6-(pyridin-2-ylmethylamino)purin-9-yl]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 170317248 |
| Molecular Formula | C24H26N8O5 |
| Molecular Weight | 506.52 g/mol |
| Exact Mass | 506.20 |
| IUPAC Name | (2S,3S,4R,5R)-N-ethyl-3,4-dihydroxy-5-[2-(5-methoxy-3-pyridinyl)-6-(pyridin-2-ylmethylamino)purin-9-yl]oxolane-2-carboxamide |
| SMILES | CCNC(=O)[C@H]1O[C@@H](n2cnc3c(NCc4ccccn4)nc(-c4cncc(OC)c4)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C24H26N8O5/c1-3-26-23(35)19-17(33)18(34)24(37-19)32-12-29-16-21(28-10-14-6-4-5-7-27-14)30-20(31-22(16)32)13-8-15(36-2)11-25-9-13/h4-9,11-12,17-19,24,33-34H,3,10H2,1-2H3,(H,26,35)(H,28,30,31)/t17-,18+,19-,24+/m0/s1 |
| InChIKey | VQQLYQKKKJPMBP-UAKAABGRSA-N |
| XLogP | 0.66 |
| TPSA | 169.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.52 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |