C23H23N7O6 — CID 175465081
(2R)-3,4-dihydroxy-N-methoxy-5-[6-(methylamino)-2-(5-phenoxy-3-pyridinyl)purin-9-yl]oxolane-2-carboxamide (PubChem CID 175465081) has the molecular formula C23H23N7O6 and a molecular weight of 493.48 g/mol. Its IUPAC name is (2R)-3,4-dihydroxy-N-methoxy-5-[6-(methylamino)-2-(5-phenoxy-3-pyridinyl)purin-9-yl]oxolane-2-carboxamide.
| Compound Name | (2R)-3,4-dihydroxy-N-methoxy-5-[6-(methylamino)-2-(5-phenoxy-3-pyridinyl)purin-9-yl]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 175465081 |
| Molecular Formula | C23H23N7O6 |
| Molecular Weight | 493.48 g/mol |
| Exact Mass | 493.17 |
| IUPAC Name | (2R)-3,4-dihydroxy-N-methoxy-5-[6-(methylamino)-2-(5-phenoxy-3-pyridinyl)purin-9-yl]oxolane-2-carboxamide |
| SMILES | CNc1nc(-c2cncc(Oc3ccccc3)c2)nc2c1ncn2C1O[C@@H](C(=O)NOC)C(O)C1O |
| InChI | InChI=1S/C23H23N7O6/c1-24-20-15-21(30(11-26-15)23-17(32)16(31)18(36-23)22(33)29-34-2)28-19(27-20)12-8-14(10-25-9-12)35-13-6-4-3-5-7-13/h3-11,16-18,23,31-32H,1-2H3,(H,29,33)(H,24,27,28)/t16?,17?,18-,23?/m1/s1 |
| InChIKey | NSRIZXCFNGTAOP-NTFGGDPESA-N |
| XLogP | 1.02 |
| TPSA | 165.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.48 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|