C23H23N7O5 — CID 167153288
(2S,4R,5R)-4-hydroxy-N-methoxy-5-[6-(methylamino)-2-(5-phenoxy-3-pyridinyl)purin-9-yl]oxolane-2-carboxamide (PubChem CID 167153288) has the molecular formula C23H23N7O5 and a molecular weight of 477.48 g/mol. Its IUPAC name is (2S,4R,5R)-4-hydroxy-N-methoxy-5-[6-(methylamino)-2-(5-phenoxy-3-pyridinyl)purin-9-yl]oxolane-2-carboxamide.
| Compound Name | (2S,4R,5R)-4-hydroxy-N-methoxy-5-[6-(methylamino)-2-(5-phenoxy-3-pyridinyl)purin-9-yl]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 167153288 |
| Molecular Formula | C23H23N7O5 |
| Molecular Weight | 477.48 g/mol |
| Exact Mass | 477.18 |
| IUPAC Name | (2S,4R,5R)-4-hydroxy-N-methoxy-5-[6-(methylamino)-2-(5-phenoxy-3-pyridinyl)purin-9-yl]oxolane-2-carboxamide |
| SMILES | CNc1nc(-c2cncc(Oc3ccccc3)c2)nc2c1ncn2[C@@H]1O[C@H](C(=O)NOC)C[C@H]1O |
| InChI | InChI=1S/C23H23N7O5/c1-24-20-18-21(30(12-26-18)23-16(31)9-17(35-23)22(32)29-33-2)28-19(27-20)13-8-15(11-25-10-13)34-14-6-4-3-5-7-14/h3-8,10-12,16-17,23,31H,9H2,1-2H3,(H,29,32)(H,24,27,28)/t16-,17+,23-/m1/s1 |
| InChIKey | IBWBZRRPQLXEIH-SAHWJRBASA-N |
| XLogP | 2.05 |
| TPSA | 145.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.48 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|