C24H21ClF3N7O3 — CID 167153030
(2S,4R,5R)-5-[6-(benzylamino)-2-(5-chloro-3-pyridinyl)purin-9-yl]-4-hydroxy-N-(2,2,2-trifluoroethyl)oxolane-2-carboxamide (PubChem CID 167153030) has the molecular formula C24H21ClF3N7O3 and a molecular weight of 547.93 g/mol. Its IUPAC name is (2S,4R,5R)-5-[6-(benzylamino)-2-(5-chloro-3-pyridinyl)purin-9-yl]-4-hydroxy-N-(2,2,2-trifluoroethyl)oxolane-2-carboxamide.
| Compound Name | (2S,4R,5R)-5-[6-(benzylamino)-2-(5-chloro-3-pyridinyl)purin-9-yl]-4-hydroxy-N-(2,2,2-trifluoroethyl)oxolane-2-carboxamide |
|---|---|
| PubChem CID | 167153030 |
| Molecular Formula | C24H21ClF3N7O3 |
| Molecular Weight | 547.93 g/mol |
| Exact Mass | 547.13 |
| IUPAC Name | (2S,4R,5R)-5-[6-(benzylamino)-2-(5-chloro-3-pyridinyl)purin-9-yl]-4-hydroxy-N-(2,2,2-trifluoroethyl)oxolane-2-carboxamide |
| SMILES | O=C(NCC(F)(F)F)[C@@H]1C[C@@H](O)[C@H](n2cnc3c(NCc4ccccc4)nc(-c4cncc(Cl)c4)nc32)O1 |
| InChI | InChI=1S/C24H21ClF3N7O3/c25-15-6-14(9-29-10-15)19-33-20(30-8-13-4-2-1-3-5-13)18-21(34-19)35(12-32-18)23-16(36)7-17(38-23)22(37)31-11-24(26,27)28/h1-6,9-10,12,16-17,23,36H,7-8,11H2,(H,31,37)(H,30,33,34)/t16-,17+,23-/m1/s1 |
| InChIKey | QFFLPERAQUZZKV-SAHWJRBASA-N |
| XLogP | 3.48 |
| TPSA | 127.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.93 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |