C24H31N9O5 — CID 132918420
(2S,3S,4R,5R)-5-[6-[[(1R)-1-[2-(diethylamino)-7-methyl-[1,3]oxazolo[4,5-b]pyridin-5-yl]ethyl]amino]purin-9-yl]-3,4-dihydroxy-N-methyloxolane-2-carboxamide (PubChem CID 132918420) has the molecular formula C24H31N9O5 and a molecular weight of 525.57 g/mol. Its IUPAC name is (2S,3S,4R,5R)-5-[6-[[(1R)-1-[2-(diethylamino)-7-methyl-[1,3]oxazolo[4,5-b]pyridin-5-yl]ethyl]amino]purin-9-yl]-3,4-dihydroxy-N-methyloxolane-2-carboxamide.
| Compound Name | (2S,3S,4R,5R)-5-[6-[[(1R)-1-[2-(diethylamino)-7-methyl-[1,3]oxazolo[4,5-b]pyridin-5-yl]ethyl]amino]purin-9-yl]-3,4-dihydroxy-N-methyloxolane-2-carboxamide |
|---|---|
| PubChem CID | 132918420 |
| Molecular Formula | C24H31N9O5 |
| Molecular Weight | 525.57 g/mol |
| Exact Mass | 525.24 |
| IUPAC Name | (2S,3S,4R,5R)-5-[6-[[(1R)-1-[2-(diethylamino)-7-methyl-[1,3]oxazolo[4,5-b]pyridin-5-yl]ethyl]amino]purin-9-yl]-3,4-dihydroxy-N-methyloxolane-2-carboxamide |
| SMILES | CCN(CC)c1nc2nc([C@@H](C)Nc3ncnc4c3ncn4[C@@H]3O[C@H](C(=O)NC)[C@@H](O)[C@H]3O)cc(C)c2o1 |
| InChI | InChI=1S/C24H31N9O5/c1-6-32(7-2)24-31-20-17(38-24)11(3)8-13(30-20)12(4)29-19-14-21(27-9-26-19)33(10-28-14)23-16(35)15(34)18(37-23)22(36)25-5/h8-10,12,15-16,18,23,34-35H,6-7H2,1-5H3,(H,25,36)(H,26,27,29)/t12-,15+,16-,18+,23-/m1/s1 |
| InChIKey | KEPOJVFIZYDANR-GLPURVRYSA-N |
| XLogP | 1.06 |
| TPSA | 176.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.57 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |