C19H23N5O3 — CID 91154483
(2R,3S,4R,5R)-2-ethynyl-5-[6-[[(1S,2R,3R,4S)-3-methyl-2-bicyclo[2.2.1]heptanyl]amino]purin-9-yl]oxolane-3,4-diol (PubChem CID 91154483) has the molecular formula C19H23N5O3 and a molecular weight of 369.43 g/mol. Its IUPAC name is (2R,3S,4R,5R)-2-ethynyl-5-[6-[[(1S,2R,3R,4S)-3-methyl-2-bicyclo[2.2.1]heptanyl]amino]purin-9-yl]oxolane-3,4-diol.
| Compound Name | (2R,3S,4R,5R)-2-ethynyl-5-[6-[[(1S,2R,3R,4S)-3-methyl-2-bicyclo[2.2.1]heptanyl]amino]purin-9-yl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 91154483 |
| Molecular Formula | C19H23N5O3 |
| Molecular Weight | 369.43 g/mol |
| Exact Mass | 369.18 |
| IUPAC Name | (2R,3S,4R,5R)-2-ethynyl-5-[6-[[(1S,2R,3R,4S)-3-methyl-2-bicyclo[2.2.1]heptanyl]amino]purin-9-yl]oxolane-3,4-diol |
| SMILES | C#C[C@H]1O[C@@H](n2cnc3c(N[C@@H]4[C@H]5CC[C@@H](C5)[C@H]4C)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C19H23N5O3/c1-3-12-15(25)16(26)19(27-12)24-8-22-14-17(20-7-21-18(14)24)23-13-9(2)10-4-5-11(13)6-10/h1,7-13,15-16,19,25-26H,4-6H2,2H3,(H,20,21,23)/t9-,10+,11+,12-,13+,15-,16-,19-/m1/s1 |
| InChIKey | TWCYYCPVTRSMDI-HSFMKOFVSA-N |
| XLogP | 0.93 |
| TPSA | 105.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.43 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|