C17H21N5O4 — CID 22219312
2-ethynyl-5-[6-(oxan-3-ylmethylamino)purin-9-yl]oxolane-3,4-diol (PubChem CID 22219312) has the molecular formula C17H21N5O4 and a molecular weight of 359.39 g/mol. Its IUPAC name is 2-ethynyl-5-[6-(oxan-3-ylmethylamino)purin-9-yl]oxolane-3,4-diol.
| Compound Name | 2-ethynyl-5-[6-(oxan-3-ylmethylamino)purin-9-yl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 22219312 |
| Molecular Formula | C17H21N5O4 |
| Molecular Weight | 359.39 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | 2-ethynyl-5-[6-(oxan-3-ylmethylamino)purin-9-yl]oxolane-3,4-diol |
| SMILES | C#CC1OC(n2cnc3c(NCC4CCCOC4)ncnc32)C(O)C1O |
| InChI | InChI=1S/C17H21N5O4/c1-2-11-13(23)14(24)17(26-11)22-9-21-12-15(19-8-20-16(12)22)18-6-10-4-3-5-25-7-10/h1,8-11,13-14,17,23-24H,3-7H2,(H,18,19,20) |
| InChIKey | DPIXLDHSEYHJGL-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 114.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.39 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|