C21H17ClFN5O5 — CID 23022907
[4-acetyloxy-5-[6-(4-chloro-2-fluoroanilino)purin-9-yl]-2-ethynyloxolan-3-yl] acetate (PubChem CID 23022907) has the molecular formula C21H17ClFN5O5 and a molecular weight of 473.85 g/mol. Its IUPAC name is [4-acetyloxy-5-[6-(4-chloro-2-fluoroanilino)purin-9-yl]-2-ethynyloxolan-3-yl] acetate.
| Compound Name | [4-acetyloxy-5-[6-(4-chloro-2-fluoroanilino)purin-9-yl]-2-ethynyloxolan-3-yl] acetate |
|---|---|
| PubChem CID | 23022907 |
| Molecular Formula | C21H17ClFN5O5 |
| Molecular Weight | 473.85 g/mol |
| Exact Mass | 473.09 |
| IUPAC Name | [4-acetyloxy-5-[6-(4-chloro-2-fluoroanilino)purin-9-yl]-2-ethynyloxolan-3-yl] acetate |
| SMILES | C#CC1OC(n2cnc3c(Nc4ccc(Cl)cc4F)ncnc32)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C21H17ClFN5O5/c1-4-15-17(31-10(2)29)18(32-11(3)30)21(33-15)28-9-26-16-19(24-8-25-20(16)28)27-14-6-5-12(22)7-13(14)23/h1,5-9,15,17-18,21H,2-3H3,(H,24,25,27) |
| InChIKey | MLGIHDBBWUOIOH-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 117.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.85 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|