C14H18N4O4 — CID 141074801
2-methyl-5-[6-(oxolan-3-yl)purin-9-yl]oxolane-3,4-diol (PubChem CID 141074801) has the molecular formula C14H18N4O4 and a molecular weight of 306.32 g/mol. Its IUPAC name is 2-methyl-5-[6-(oxolan-3-yl)purin-9-yl]oxolane-3,4-diol.
| Compound Name | 2-methyl-5-[6-(oxolan-3-yl)purin-9-yl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 141074801 |
| Molecular Formula | C14H18N4O4 |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.13 |
| IUPAC Name | 2-methyl-5-[6-(oxolan-3-yl)purin-9-yl]oxolane-3,4-diol |
| SMILES | CC1OC(n2cnc3c(C4CCOC4)ncnc32)C(O)C1O |
| InChI | InChI=1S/C14H18N4O4/c1-7-11(19)12(20)14(22-7)18-6-17-10-9(8-2-3-21-4-8)15-5-16-13(10)18/h5-8,11-12,14,19-20H,2-4H2,1H3 |
| InChIKey | JDIMQVCHTQUCER-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 102.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |