C18H18N6O5S — CID 58296167
9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-[(sulfamoylamino)methyl]oxolan-2-yl]-6-(2-phenylethynyl)purine (PubChem CID 58296167) has the molecular formula C18H18N6O5S and a molecular weight of 430.45 g/mol. Its IUPAC name is 9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-[(sulfamoylamino)methyl]oxolan-2-yl]-6-(2-phenylethynyl)purine.
| Compound Name | 9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-[(sulfamoylamino)methyl]oxolan-2-yl]-6-(2-phenylethynyl)purine |
|---|---|
| PubChem CID | 58296167 |
| Molecular Formula | C18H18N6O5S |
| Molecular Weight | 430.45 g/mol |
| Exact Mass | 430.11 |
| IUPAC Name | 9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-[(sulfamoylamino)methyl]oxolan-2-yl]-6-(2-phenylethynyl)purine |
| SMILES | NS(=O)(=O)NC[C@H]1O[C@@H](n2cnc3c(C#Cc4ccccc4)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C18H18N6O5S/c19-30(27,28)23-8-13-15(25)16(26)18(29-13)24-10-22-14-12(20-9-21-17(14)24)7-6-11-4-2-1-3-5-11/h1-5,9-10,13,15-16,18,23,25-26H,8H2,(H2,19,27,28)/t13-,15-,16-,18-/m1/s1 |
| InChIKey | RRBDKNMCJCSIIS-GFOCRRMGSA-N |
| XLogP | -1.36 |
| TPSA | 165.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.45 |
| LogP ≤ 5 | -1.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|