C19H22N6O7S — CID 59848425
N-[[(2R,3R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl]-1-[2-(2-hydroxyphenyl)oxiran-2-yl]methanesulfonamide (PubChem CID 59848425) has the molecular formula C19H22N6O7S and a molecular weight of 478.49 g/mol. Its IUPAC name is N-[[(2R,3R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl]-1-[2-(2-hydroxyphenyl)oxiran-2-yl]methanesulfonamide.
| Compound Name | N-[[(2R,3R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl]-1-[2-(2-hydroxyphenyl)oxiran-2-yl]methanesulfonamide |
|---|---|
| PubChem CID | 59848425 |
| Molecular Formula | C19H22N6O7S |
| Molecular Weight | 478.49 g/mol |
| Exact Mass | 478.13 |
| IUPAC Name | N-[[(2R,3R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl]-1-[2-(2-hydroxyphenyl)oxiran-2-yl]methanesulfonamide |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](CNS(=O)(=O)CC2(c3ccccc3O)CO2)[C@H](O)C1O |
| InChI | InChI=1S/C19H22N6O7S/c20-16-13-17(22-8-21-16)25(9-23-13)18-15(28)14(27)12(32-18)5-24-33(29,30)7-19(6-31-19)10-3-1-2-4-11(10)26/h1-4,8-9,12,14-15,18,24,26-28H,5-7H2,(H2,20,21,22)/t12-,14+,15?,18-,19?/m1/s1 |
| InChIKey | NYIKTWLKURBWAY-UEIOKRHKSA-N |
| XLogP | -1.42 |
| TPSA | 198.24 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.49 |
| LogP ≤ 5 | -1.42 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|