C18H20ClN7O5S — CID 137470702
(E)-2-(2-amino-3-chlorophenyl)-N-[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl]ethenesulfonamide (PubChem CID 137470702) has the molecular formula C18H20ClN7O5S and a molecular weight of 481.92 g/mol. Its IUPAC name is (E)-2-(2-amino-3-chlorophenyl)-N-[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl]ethenesulfonamide.
| Compound Name | (E)-2-(2-amino-3-chlorophenyl)-N-[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl]ethenesulfonamide |
|---|---|
| PubChem CID | 137470702 |
| Molecular Formula | C18H20ClN7O5S |
| Molecular Weight | 481.92 g/mol |
| Exact Mass | 481.09 |
| IUPAC Name | (E)-2-(2-amino-3-chlorophenyl)-N-[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl]ethenesulfonamide |
| SMILES | Nc1c(Cl)cccc1/C=C/S(=O)(=O)NC[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C18H20ClN7O5S/c19-10-3-1-2-9(12(10)20)4-5-32(29,30)25-6-11-14(27)15(28)18(31-11)26-8-24-13-16(21)22-7-23-17(13)26/h1-5,7-8,11,14-15,18,25,27-28H,6,20H2,(H2,21,22,23)/b5-4+/t11-,14-,15-,18-/m1/s1 |
| InChIKey | FNADDUBAQQIDMX-SCXBOCMKSA-N |
| XLogP | -0.15 |
| TPSA | 191.50 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.92 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|