C25H29N9O5S — CID 137470754
(E)-N-[[(2R,3S,4R,5R)-5-[6-amino-2-[4-(aminomethyl)anilino]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methyl]-2-(2-aminophenyl)ethenesulfonamide (PubChem CID 137470754) has the molecular formula C25H29N9O5S and a molecular weight of 567.63 g/mol. Its IUPAC name is (E)-N-[[(2R,3S,4R,5R)-5-[6-amino-2-[4-(aminomethyl)anilino]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methyl]-2-(2-aminophenyl)ethenesulfonamide.
| Compound Name | (E)-N-[[(2R,3S,4R,5R)-5-[6-amino-2-[4-(aminomethyl)anilino]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methyl]-2-(2-aminophenyl)ethenesulfonamide |
|---|---|
| PubChem CID | 137470754 |
| Molecular Formula | C25H29N9O5S |
| Molecular Weight | 567.63 g/mol |
| Exact Mass | 567.20 |
| IUPAC Name | (E)-N-[[(2R,3S,4R,5R)-5-[6-amino-2-[4-(aminomethyl)anilino]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methyl]-2-(2-aminophenyl)ethenesulfonamide |
| SMILES | NCc1ccc(Nc2nc(N)c3ncn([C@@H]4O[C@H](CNS(=O)(=O)/C=C/c5ccccc5N)[C@@H](O)[C@H]4O)c3n2)cc1 |
| InChI | InChI=1S/C25H29N9O5S/c26-11-14-5-7-16(8-6-14)31-25-32-22(28)19-23(33-25)34(13-29-19)24-21(36)20(35)18(39-24)12-30-40(37,38)10-9-15-3-1-2-4-17(15)27/h1-10,13,18,20-21,24,30,35-36H,11-12,26-27H2,(H3,28,31,32,33)/b10-9+/t18-,20-,21-,24-/m1/s1 |
| InChIKey | DFPITGIEFNZUFI-YSKCLZGSSA-N |
| XLogP | 0.40 |
| TPSA | 229.55 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.63 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|