C20H24N6O7S — CID 157101938
(2R,3R,4S,5R)-2-(7-aminoimidazo[4,5-b]pyridin-3-yl)-5-[[[3-(2-hydroxyphenyl)oxetan-3-yl]sulfamoylamino]methyl]oxolane-3,4-diol (PubChem CID 157101938) has the molecular formula C20H24N6O7S and a molecular weight of 492.51 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-(7-aminoimidazo[4,5-b]pyridin-3-yl)-5-[[[3-(2-hydroxyphenyl)oxetan-3-yl]sulfamoylamino]methyl]oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-(7-aminoimidazo[4,5-b]pyridin-3-yl)-5-[[[3-(2-hydroxyphenyl)oxetan-3-yl]sulfamoylamino]methyl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 157101938 |
| Molecular Formula | C20H24N6O7S |
| Molecular Weight | 492.51 g/mol |
| Exact Mass | 492.14 |
| IUPAC Name | (2R,3R,4S,5R)-2-(7-aminoimidazo[4,5-b]pyridin-3-yl)-5-[[[3-(2-hydroxyphenyl)oxetan-3-yl]sulfamoylamino]methyl]oxolane-3,4-diol |
| SMILES | Nc1ccnc2c1ncn2[C@@H]1O[C@H](CNS(=O)(=O)NC2(c3ccccc3O)COC2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C20H24N6O7S/c21-12-5-6-22-18-15(12)23-10-26(18)19-17(29)16(28)14(33-19)7-24-34(30,31)25-20(8-32-9-20)11-3-1-2-4-13(11)27/h1-6,10,14,16-17,19,24-25,27-29H,7-9H2,(H2,21,22)/t14-,16-,17-,19-/m1/s1 |
| InChIKey | WZQQFAGIOQLLOL-KLICCBINSA-N |
| XLogP | -1.31 |
| TPSA | 194.08 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.51 |
| LogP ≤ 5 | -1.31 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|