C22H19F2N7O8S — CID 130382999
N-[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methylsulfamoyl]-3-(2,2-difluoro-1-hydroxy-3-oxoinden-1-yl)prop-2-ynamide (PubChem CID 130382999) has the molecular formula C22H19F2N7O8S and a molecular weight of 579.50 g/mol. Its IUPAC name is N-[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methylsulfamoyl]-3-(2,2-difluoro-1-hydroxy-3-oxoinden-1-yl)prop-2-ynamide.
| Compound Name | N-[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methylsulfamoyl]-3-(2,2-difluoro-1-hydroxy-3-oxoinden-1-yl)prop-2-ynamide |
|---|---|
| PubChem CID | 130382999 |
| Molecular Formula | C22H19F2N7O8S |
| Molecular Weight | 579.50 g/mol |
| Exact Mass | 579.10 |
| IUPAC Name | N-[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methylsulfamoyl]-3-(2,2-difluoro-1-hydroxy-3-oxoinden-1-yl)prop-2-ynamide |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](CNS(=O)(=O)NC(=O)C#CC2(O)c3ccccc3C(=O)C2(F)F)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C22H19F2N7O8S/c23-22(24)17(35)10-3-1-2-4-11(10)21(22,36)6-5-13(32)30-40(37,38)29-7-12-15(33)16(34)20(39-12)31-9-28-14-18(25)26-8-27-19(14)31/h1-4,8-9,12,15-16,20,29,33-34,36H,7H2,(H,30,32)(H2,25,26,27)/t12-,15-,16-,20-,21?/m1/s1 |
| InChIKey | BITSJBTWBQRAAD-KFVIYTPQSA-N |
| XLogP | -2.30 |
| TPSA | 231.88 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.50 |
| LogP ≤ 5 | -2.30 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|