C9H12FN3O6 — CID 163541264
1-[(2R,3S,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-fluoro-4-(hydroxyamino)pyrimidin-2-one (PubChem CID 163541264) has the molecular formula C9H12FN3O6 and a molecular weight of 277.21 g/mol. Its IUPAC name is 1-[(2R,3S,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-fluoro-4-(hydroxyamino)pyrimidin-2-one.
| Compound Name | 1-[(2R,3S,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-fluoro-4-(hydroxyamino)pyrimidin-2-one |
|---|---|
| PubChem CID | 163541264 |
| Molecular Formula | C9H12FN3O6 |
| Molecular Weight | 277.21 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | 1-[(2R,3S,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-fluoro-4-(hydroxyamino)pyrimidin-2-one |
| SMILES | O=c1nc(NO)c(F)cn1[C@@H]1O[C@H](CO)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C9H12FN3O6/c10-3-1-13(9(17)11-7(3)12-18)8-6(16)5(15)4(2-14)19-8/h1,4-6,8,14-16,18H,2H2,(H,11,12,17)/t4-,5+,6+,8-/m1/s1 |
| InChIKey | FBGTUUWFXKRMTO-FZGKIIIMSA-N |
| XLogP | -2.20 |
| TPSA | 137.07 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.21 |
| LogP ≤ 5 | -2.20 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|