C10H13N5O5 — CID 102168841
1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-methylimidazo[4,5-e][1,2,4]triazin-6-one (PubChem CID 102168841) has the molecular formula C10H13N5O5 and a molecular weight of 283.24 g/mol. Its IUPAC name is 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-methylimidazo[4,5-e][1,2,4]triazin-6-one.
| Compound Name | 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-methylimidazo[4,5-e][1,2,4]triazin-6-one |
|---|---|
| PubChem CID | 102168841 |
| Molecular Formula | C10H13N5O5 |
| Molecular Weight | 283.24 g/mol |
| Exact Mass | 283.09 |
| IUPAC Name | 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-methylimidazo[4,5-e][1,2,4]triazin-6-one |
| SMILES | Cn1c2ncnn([C@@H]3O[C@H](CO)[C@@H](O)[C@H]3O)c-2nc1=O |
| InChI | InChI=1S/C10H13N5O5/c1-14-7-8(13-10(14)19)15(12-3-11-7)9-6(18)5(17)4(2-16)20-9/h3-6,9,16-18H,2H2,1H3/t4-,5-,6-,9-/m1/s1 |
| InChIKey | FTGMTTBNCQEEAK-MWKIOEHESA-N |
| XLogP | -2.91 |
| TPSA | 135.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.24 |
| LogP ≤ 5 | -2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |