C29H32N4O9 — CID 164541235
[(2R,3S,4R,5R)-5-(3,5-dioxo-1,2,4-triazin-2-yl)-3,4-dihydroxyoxolan-2-yl]methyl (2R,3R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylpentanoate (PubChem CID 164541235) has the molecular formula C29H32N4O9 and a molecular weight of 580.59 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-(3,5-dioxo-1,2,4-triazin-2-yl)-3,4-dihydroxyoxolan-2-yl]methyl (2R,3R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylpentanoate.
| Compound Name | [(2R,3S,4R,5R)-5-(3,5-dioxo-1,2,4-triazin-2-yl)-3,4-dihydroxyoxolan-2-yl]methyl (2R,3R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylpentanoate |
|---|---|
| PubChem CID | 164541235 |
| Molecular Formula | C29H32N4O9 |
| Molecular Weight | 580.59 g/mol |
| Exact Mass | 580.22 |
| IUPAC Name | [(2R,3S,4R,5R)-5-(3,5-dioxo-1,2,4-triazin-2-yl)-3,4-dihydroxyoxolan-2-yl]methyl (2R,3R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylpentanoate |
| SMILES | CC[C@@H](C)[C@@H](NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)OC[C@H]1O[C@@H](n2ncc(=O)[nH]c2=O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C29H32N4O9/c1-3-15(2)23(27(37)40-14-21-24(35)25(36)26(42-21)33-28(38)31-22(34)12-30-33)32-29(39)41-13-20-18-10-6-4-8-16(18)17-9-5-7-11-19(17)20/h4-12,15,20-21,23-26,35-36H,3,13-14H2,1-2H3,(H,32,39)(H,31,34,38)/t15-,21-,23-,24-,25-,26-/m1/s1 |
| InChIKey | XTQGRCYMJSCWMG-YCUWRZNESA-N |
| XLogP | 1.05 |
| TPSA | 182.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.59 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |