C18H25N3O6S — CID 163956962
[(2R,3S,4R,5R)-3,4-dihydroxy-5-(5-methyl-2-methylidene-7-oxo-6H-[1,3]thiazolo[4,5-d]pyrimidin-3-yl)oxolan-2-yl]methyl (2S)-2,3-dimethylbutanoate (PubChem CID 163956962) has the molecular formula C18H25N3O6S and a molecular weight of 411.48 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-3,4-dihydroxy-5-(5-methyl-2-methylidene-7-oxo-6H-[1,3]thiazolo[4,5-d]pyrimidin-3-yl)oxolan-2-yl]methyl (2S)-2,3-dimethylbutanoate.
| Compound Name | [(2R,3S,4R,5R)-3,4-dihydroxy-5-(5-methyl-2-methylidene-7-oxo-6H-[1,3]thiazolo[4,5-d]pyrimidin-3-yl)oxolan-2-yl]methyl (2S)-2,3-dimethylbutanoate |
|---|---|
| PubChem CID | 163956962 |
| Molecular Formula | C18H25N3O6S |
| Molecular Weight | 411.48 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | [(2R,3S,4R,5R)-3,4-dihydroxy-5-(5-methyl-2-methylidene-7-oxo-6H-[1,3]thiazolo[4,5-d]pyrimidin-3-yl)oxolan-2-yl]methyl (2S)-2,3-dimethylbutanoate |
| SMILES | C=C1Sc2c(nc(C)[nH]c2=O)N1[C@@H]1O[C@H](COC(=O)[C@@H](C)C(C)C)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C18H25N3O6S/c1-7(2)8(3)18(25)26-6-11-12(22)13(23)17(27-11)21-10(5)28-14-15(21)19-9(4)20-16(14)24/h7-8,11-13,17,22-23H,5-6H2,1-4H3,(H,19,20,24)/t8-,11+,12+,13+,17+/m0/s1 |
| InChIKey | FJODLZBUDNYHBU-WULGRLCZSA-N |
| XLogP | 0.74 |
| TPSA | 124.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.48 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |