C12H16N4O5S2 — CID 11617448
5-amino-3-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-7-ethoxy-[1,3]thiazolo[4,5-d]pyrimidine-2-thione (PubChem CID 11617448) has the molecular formula C12H16N4O5S2 and a molecular weight of 360.42 g/mol. Its IUPAC name is 5-amino-3-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-7-ethoxy-[1,3]thiazolo[4,5-d]pyrimidine-2-thione.
| Compound Name | 5-amino-3-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-7-ethoxy-[1,3]thiazolo[4,5-d]pyrimidine-2-thione |
|---|---|
| PubChem CID | 11617448 |
| Molecular Formula | C12H16N4O5S2 |
| Molecular Weight | 360.42 g/mol |
| Exact Mass | 360.06 |
| IUPAC Name | 5-amino-3-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-7-ethoxy-[1,3]thiazolo[4,5-d]pyrimidine-2-thione |
| SMILES | CCOc1nc(N)nc2c1sc(=S)n2[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C12H16N4O5S2/c1-2-20-9-7-8(14-11(13)15-9)16(12(22)23-7)10-6(19)5(18)4(3-17)21-10/h4-6,10,17-19H,2-3H2,1H3,(H2,13,14,15)/t4-,5-,6-,10-/m1/s1 |
| InChIKey | JBUHMWMOJHUUBY-PLDPKQSISA-N |
| XLogP | -0.19 |
| TPSA | 135.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.42 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|