C16H23N3O5S2 — CID 90392986
2-amino-9-[[(2S,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]methyl]-4-ethoxy-8,9-dihydro-7H-thiepino[3,2-d]pyrimidine-6-thione (PubChem CID 90392986) has the molecular formula C16H23N3O5S2 and a molecular weight of 401.51 g/mol. Its IUPAC name is 2-amino-9-[[(2S,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]methyl]-4-ethoxy-8,9-dihydro-7H-thiepino[3,2-d]pyrimidine-6-thione.
| Compound Name | 2-amino-9-[[(2S,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]methyl]-4-ethoxy-8,9-dihydro-7H-thiepino[3,2-d]pyrimidine-6-thione |
|---|---|
| PubChem CID | 90392986 |
| Molecular Formula | C16H23N3O5S2 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.11 |
| IUPAC Name | 2-amino-9-[[(2S,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]methyl]-4-ethoxy-8,9-dihydro-7H-thiepino[3,2-d]pyrimidine-6-thione |
| SMILES | CCOc1nc(N)nc2c1SC(=S)CCC2C[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C16H23N3O5S2/c1-2-23-15-14-11(18-16(17)19-15)7(3-4-10(25)26-14)5-8-12(21)13(22)9(6-20)24-8/h7-9,12-13,20-22H,2-6H2,1H3,(H2,17,18,19)/t7?,8-,9+,12-,13+/m0/s1 |
| InChIKey | CZBUJEXTQGJELJ-RPLCLQMISA-N |
| XLogP | 0.63 |
| TPSA | 130.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|