C23H24ClN5O5 — CID 169004599
[(3R,4R,5R)-4-acetyloxy-5-[6-chloro-2-hex-1-ynyl-8-(1H-pyrrol-2-yl)purin-9-yl]oxolan-3-yl] acetate (PubChem CID 169004599) has the molecular formula C23H24ClN5O5 and a molecular weight of 485.93 g/mol. Its IUPAC name is [(3R,4R,5R)-4-acetyloxy-5-[6-chloro-2-hex-1-ynyl-8-(1H-pyrrol-2-yl)purin-9-yl]oxolan-3-yl] acetate.
| Compound Name | [(3R,4R,5R)-4-acetyloxy-5-[6-chloro-2-hex-1-ynyl-8-(1H-pyrrol-2-yl)purin-9-yl]oxolan-3-yl] acetate |
|---|---|
| PubChem CID | 169004599 |
| Molecular Formula | C23H24ClN5O5 |
| Molecular Weight | 485.93 g/mol |
| Exact Mass | 485.15 |
| IUPAC Name | [(3R,4R,5R)-4-acetyloxy-5-[6-chloro-2-hex-1-ynyl-8-(1H-pyrrol-2-yl)purin-9-yl]oxolan-3-yl] acetate |
| SMILES | CCCCC#Cc1nc(Cl)c2nc(-c3ccc[nH]3)n([C@@H]3OC[C@@H](OC(C)=O)[C@H]3OC(C)=O)c2n1 |
| InChI | InChI=1S/C23H24ClN5O5/c1-4-5-6-7-10-17-26-20(24)18-22(27-17)29(21(28-18)15-9-8-11-25-15)23-19(34-14(3)31)16(12-32-23)33-13(2)30/h8-9,11,16,19,23,25H,4-6,12H2,1-3H3/t16-,19-,23-/m1/s1 |
| InChIKey | OYVPRQAHXQIHJL-ZDWFVDTJSA-N |
| XLogP | 3.41 |
| TPSA | 121.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.93 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|