C22H20ClN5O3S — CID 174158596
(2R,3R,4R)-2-[8-(1,3-benzothiazol-2-yl)-6-chloro-2-hex-1-ynylpurin-9-yl]oxolane-3,4-diol (PubChem CID 174158596) has the molecular formula C22H20ClN5O3S and a molecular weight of 469.95 g/mol. Its IUPAC name is (2R,3R,4R)-2-[8-(1,3-benzothiazol-2-yl)-6-chloro-2-hex-1-ynylpurin-9-yl]oxolane-3,4-diol.
| Compound Name | (2R,3R,4R)-2-[8-(1,3-benzothiazol-2-yl)-6-chloro-2-hex-1-ynylpurin-9-yl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 174158596 |
| Molecular Formula | C22H20ClN5O3S |
| Molecular Weight | 469.95 g/mol |
| Exact Mass | 469.10 |
| IUPAC Name | (2R,3R,4R)-2-[8-(1,3-benzothiazol-2-yl)-6-chloro-2-hex-1-ynylpurin-9-yl]oxolane-3,4-diol |
| SMILES | CCCCC#Cc1nc(Cl)c2nc(-c3nc4ccccc4s3)n([C@@H]3OC[C@@H](O)[C@H]3O)c2n1 |
| InChI | InChI=1S/C22H20ClN5O3S/c1-2-3-4-5-10-15-25-18(23)16-19(26-15)28(22-17(30)13(29)11-31-22)20(27-16)21-24-12-8-6-7-9-14(12)32-21/h6-9,13,17,22,29-30H,2-4,11H2,1H3/t13-,17-,22-/m1/s1 |
| InChIKey | XOEJAZKZPHIZJM-NYFKNOIKSA-N |
| XLogP | 3.55 |
| TPSA | 106.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.95 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|