C19H20ClN5OS — CID 169004532
5-[6-chloro-8-hex-1-ynyl-9-(oxan-2-yl)purin-2-yl]-1,3-thiazole (PubChem CID 169004532) has the molecular formula C19H20ClN5OS and a molecular weight of 401.92 g/mol. Its IUPAC name is 5-[6-chloro-8-hex-1-ynyl-9-(oxan-2-yl)purin-2-yl]-1,3-thiazole.
| Compound Name | 5-[6-chloro-8-hex-1-ynyl-9-(oxan-2-yl)purin-2-yl]-1,3-thiazole |
|---|---|
| PubChem CID | 169004532 |
| Molecular Formula | C19H20ClN5OS |
| Molecular Weight | 401.92 g/mol |
| Exact Mass | 401.11 |
| IUPAC Name | 5-[6-chloro-8-hex-1-ynyl-9-(oxan-2-yl)purin-2-yl]-1,3-thiazole |
| SMILES | CCCCC#Cc1nc2c(Cl)nc(-c3cncs3)nc2n1C1CCCCO1 |
| InChI | InChI=1S/C19H20ClN5OS/c1-2-3-4-5-8-14-22-16-17(20)23-18(13-11-21-12-27-13)24-19(16)25(14)15-9-6-7-10-26-15/h11-12,15H,2-4,6-7,9-10H2,1H3 |
| InChIKey | ITOGBTNPCQZFMI-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 65.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.92 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|