C11H13ClN4O — CID 118988228
3-chloro-5-methyl-1-(oxan-2-yl)pyrazolo[3,4-b]pyrazine (PubChem CID 118988228) has the molecular formula C11H13ClN4O and a molecular weight of 252.70 g/mol. Its IUPAC name is 3-chloro-5-methyl-1-(oxan-2-yl)pyrazolo[3,4-b]pyrazine.
| Compound Name | 3-chloro-5-methyl-1-(oxan-2-yl)pyrazolo[3,4-b]pyrazine |
|---|---|
| PubChem CID | 118988228 |
| Molecular Formula | C11H13ClN4O |
| Molecular Weight | 252.70 g/mol |
| Exact Mass | 252.08 |
| IUPAC Name | 3-chloro-5-methyl-1-(oxan-2-yl)pyrazolo[3,4-b]pyrazine |
| SMILES | Cc1cnc2c(n1)c(Cl)nn2C1CCCCO1 |
| InChI | InChI=1S/C11H13ClN4O/c1-7-6-13-11-9(14-7)10(12)15-16(11)8-4-2-3-5-17-8/h6,8H,2-5H2,1H3 |
| InChIKey | LVYMZEGUEILJQF-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.70 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |